C23H36N4O2 — CID 3495110
N-[3-[bis(2-methylpropyl)amino]propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide (PubChem CID 3495110) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-[3-[bis(2-methylpropyl)amino]propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide.
| Compound Name | N-[3-[bis(2-methylpropyl)amino]propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide |
|---|---|
| PubChem CID | 3495110 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | N-[3-[bis(2-methylpropyl)amino]propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide |
| SMILES | CC(C)CN(CCCNC(=O)CN1NC(c2ccccc2)=CCC1=O)CC(C)C |
| InChI | InChI=1S/C23H36N4O2/c1-18(2)15-26(16-19(3)4)14-8-13-24-22(28)17-27-23(29)12-11-21(25-27)20-9-6-5-7-10-20/h5-7,9-11,18-19,25H,8,12-17H2,1-4H3,(H,24,28) |
| InChIKey | NEFFPNQJCFCVTL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|