C27H35N4O2+ — CID 3495514
N-[3-(4-benzylpiperidin-1-ium-1-yl)propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide (PubChem CID 3495514) has the molecular formula C27H35N4O2+ and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-ium-1-yl)propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide.
| Compound Name | N-[3-(4-benzylpiperidin-1-ium-1-yl)propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide |
|---|---|
| PubChem CID | 3495514 |
| Molecular Formula | C27H35N4O2+ |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-ium-1-yl)propyl]-2-(3-oxo-6-phenyl-1,4-dihydropyridazin-2-yl)acetamide |
| SMILES | O=C(CN1NC(c2ccccc2)=CCC1=O)NCCC[NH+]1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H34N4O2/c32-26(21-31-27(33)13-12-25(29-31)24-10-5-2-6-11-24)28-16-7-17-30-18-14-23(15-19-30)20-22-8-3-1-4-9-22/h1-6,8-12,23,29H,7,13-21H2,(H,28,32)/p+1 |
| InChIKey | BUAGFLNKZILBFI-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|