C42H43ClF3NO4 — CID 3303246
[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 3303246) has the molecular formula C42H43ClF3NO4 and a molecular weight of 718.26 g/mol. Its IUPAC name is [5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | [5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 3303246 |
| Molecular Formula | C42H43ClF3NO4 |
| Molecular Weight | 718.26 g/mol |
| Exact Mass | 717.28 |
| IUPAC Name | [5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]-[5-(1,3-dihydroisoindol-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2Cc3ccccc3C2)c2ccc(cc2C(=O)c2ccc(-c3cc(C(F)(F)F)ccc3Cl)o2)CC(O)CC1 |
| InChI | InChI=1S/C42H43ClF3NO4/c1-26-6-5-18-40(2)35(17-19-41(40,50)25-47-23-28-7-3-4-8-29(28)24-47)32-13-10-27(20-31(48)12-9-26)21-33(32)39(49)38-16-15-37(51-38)34-22-30(42(44,45)46)11-14-36(34)43/h3-4,6-8,10-11,13-16,21-22,31,35,48,50H,5,9,12,17-20,23-25H2,1-2H3 |
| InChIKey | SCCBUMLHNCODIR-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.26 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|