C35H44F3NO3 — CID 4990857
[5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 4990857) has the molecular formula C35H44F3NO3 and a molecular weight of 583.74 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 4990857 |
| Molecular Formula | C35H44F3NO3 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCCCC2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C35H44F3NO3/c1-24-8-7-16-33(2)31(15-17-34(33,42)23-39-18-4-3-5-19-39)29-14-12-25(20-28(40)13-11-24)21-30(29)32(41)26-9-6-10-27(22-26)35(36,37)38/h6,8-10,12,14,21-22,28,31,40,42H,3-5,7,11,13,15-20,23H2,1-2H3 |
| InChIKey | LCDHGRFBPXWNCB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|