C37H49ClFNO3 — CID 4251838
1-[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 4251838) has the molecular formula C37H49ClFNO3 and a molecular weight of 610.25 g/mol. Its IUPAC name is 1-[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 4251838 |
| Molecular Formula | C37H49ClFNO3 |
| Molecular Weight | 610.25 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 1-[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCCCCCC2)c2ccc(cc2C(=O)Cc2c(F)cccc2Cl)CC(O)CC1 |
| InChI | InChI=1S/C37H49ClFNO3/c1-26-10-9-18-36(2)32(17-19-37(36,43)25-40-20-6-4-3-5-7-21-40)29-16-14-27(22-28(41)15-13-26)23-30(29)35(42)24-31-33(38)11-8-12-34(31)39/h8,10-12,14,16,23,28,32,41,43H,3-7,9,13,15,17-22,24-25H2,1-2H3 |
| InChIKey | WKXGMCDCRZNZMQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.25 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|