C36H45NO3S — CID 6725459
1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone (PubChem CID 6725459) has the molecular formula C36H45NO3S and a molecular weight of 571.83 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
|---|---|
| PubChem CID | 6725459 |
| Molecular Formula | C36H45NO3S |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | 1-benzothiophen-2-yl-[(2S,5S,6S,13S)-5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN2CCCCC2)c2ccc(cc2C(=O)c2cc3ccccc3s2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C36H45NO3S/c1-25-9-8-17-35(2)31(16-18-36(35,40)24-37-19-6-3-7-20-37)29-15-13-26(21-28(38)14-12-25)22-30(29)34(39)33-23-27-10-4-5-11-32(27)41-33/h4-5,9-11,13,15,22-23,28,31,38,40H,3,6-8,12,14,16-21,24H2,1-2H3/t28-,31-,35-,36+/m0/s1 |
| InChIKey | LCTQKVGNSLNTEF-NJLSNJMASA-N |
| XLogP | 7.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|