C41H45NO5S4 — CID 4056725
N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide (PubChem CID 4056725) has the molecular formula C41H45NO5S4 and a molecular weight of 760.08 g/mol. Its IUPAC name is N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide.
| Compound Name | N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4056725 |
| Molecular Formula | C41H45NO5S4 |
| Molecular Weight | 760.08 g/mol |
| Exact Mass | 759.22 |
| IUPAC Name | N-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(2-thiophen-2-ylethyl)thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CCc2cccs2)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2cc3ccccc3s2)CC(O)CC1 |
| InChI | InChI=1S/C41H45NO5S4/c1-28-8-5-19-40(2)35(17-20-41(40,45)27-42(21-18-32-10-6-22-48-32)51(46,47)38-12-7-23-49-38)33-16-14-29(24-31(43)15-13-28)25-34(33)39(44)37-26-30-9-3-4-11-36(30)50-37/h3-4,6-12,14,16,22-23,25-26,31,35,43,45H,5,13,15,17-21,24,27H2,1-2H3 |
| InChIKey | SBUKBYVUAQUEBU-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.08 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|