C44H55NO5S2 — CID 3590988
N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]thiophene-2-sulfonamide (PubChem CID 3590988) has the molecular formula C44H55NO5S2 and a molecular weight of 742.06 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3590988 |
| Molecular Formula | C44H55NO5S2 |
| Molecular Weight | 742.06 g/mol |
| Exact Mass | 741.35 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl)methyl]thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC23CC4CC(CC(C4)C2)C3)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2ccccc2)CC(O)CC1 |
| InChI | InChI=1S/C44H55NO5S2/c1-30-8-6-17-42(2)39(37-15-13-31(23-36(46)14-12-30)24-38(37)41(47)35-9-4-3-5-10-35)16-18-44(42,48)29-45(52(49,50)40-11-7-19-51-40)28-43-25-32-20-33(26-43)22-34(21-32)27-43/h3-5,7-11,13,15,19,24,32-34,36,39,46,48H,6,12,14,16-18,20-23,25-29H2,1-2H3 |
| InChIKey | XOGPIAXRELYKNP-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.06 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|