C37H45ClFNO5S2 — CID 3651443
N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide (PubChem CID 3651443) has the molecular formula C37H45ClFNO5S2 and a molecular weight of 702.35 g/mol. Its IUPAC name is N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide.
| Compound Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3651443 |
| Molecular Formula | C37H45ClFNO5S2 |
| Molecular Weight | 702.35 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C37H45ClFNO5S2/c1-4-19-40(47(44,45)35-11-7-20-46-35)24-37(43)18-16-31-28-15-13-26(21-27(41)14-12-25(2)8-6-17-36(31,37)3)22-29(28)34(42)23-30-32(38)9-5-10-33(30)39/h5,7-11,13,15,20,22,27,31,41,43H,4,6,12,14,16-19,21,23-24H2,1-3H3 |
| InChIKey | CGXKWEYKBLORQR-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.35 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|