C40H43F2NO5S2 — CID 4078236
N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide (PubChem CID 4078236) has the molecular formula C40H43F2NO5S2 and a molecular weight of 719.92 g/mol. Its IUPAC name is N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4078236 |
| Molecular Formula | C40H43F2NO5S2 |
| Molecular Weight | 719.92 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | N-benzyl-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccccc2)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C40H43F2NO5S2/c1-27-8-6-19-39(2)34(18-20-40(39,46)26-43(25-28-9-4-3-5-10-28)50(47,48)37-11-7-21-49-37)32-16-13-29(22-31(44)15-12-27)23-33(32)38(45)30-14-17-35(41)36(42)24-30/h3-5,7-11,13-14,16-17,21,23-24,31,34,44,46H,6,12,15,18-20,22,25-26H2,1-2H3 |
| InChIKey | YPEIEINXURCYGH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.92 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|