C44H45F2NO5S2 — CID 3416465
N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)thiophene-2-sulfonamide (PubChem CID 3416465) has the molecular formula C44H45F2NO5S2 and a molecular weight of 769.98 g/mol. Its IUPAC name is N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3416465 |
| Molecular Formula | C44H45F2NO5S2 |
| Molecular Weight | 769.98 g/mol |
| Exact Mass | 769.27 |
| IUPAC Name | N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(naphthalen-1-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2cccc3ccccc23)S(=O)(=O)c2cccs2)c2ccc(cc2C(=O)c2ccc(F)c(F)c2)CC(O)CC1 |
| InChI | InChI=1S/C44H45F2NO5S2/c1-29-8-6-21-43(2)38(36-18-15-30(24-34(48)17-14-29)25-37(36)42(49)32-16-19-39(45)40(46)26-32)20-22-44(43,50)28-47(54(51,52)41-13-7-23-53-41)27-33-11-5-10-31-9-3-4-12-35(31)33/h3-5,7-13,15-16,18-19,23,25-26,34,38,48,50H,6,14,17,20-22,24,27-28H2,1-2H3 |
| InChIKey | QEHCYNBVDITCPF-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.98 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|