C44H53F2NO5S2 — CID 3331092
N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]thiophene-2-sulfonamide (PubChem CID 3331092) has the molecular formula C44H53F2NO5S2 and a molecular weight of 778.04 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3331092 |
| Molecular Formula | C44H53F2NO5S2 |
| Molecular Weight | 778.04 g/mol |
| Exact Mass | 777.33 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]thiophene-2-sulfonamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(CC12CC3CC(CC(C3)C1)C2)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C44H53F2NO5S2/c1-39-10-7-31(48)23-42(39)13-14-44(32(24-42)38(49)30-5-6-33(45)34(46)19-30)35(39)8-11-40(2)36(44)9-12-43(40,50)26-47(54(51,52)37-4-3-15-53-37)25-41-20-27-16-28(21-41)18-29(17-27)22-41/h3-6,13-15,19,24,27-29,31,35-36,48,50H,7-12,16-18,20-23,25-26H2,1-2H3 |
| InChIKey | FSYVCWRUZGQZTF-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.04 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|