C38H45F2NO5S — CID 3594078
ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 3594078) has the molecular formula C38H45F2NO5S and a molecular weight of 665.84 g/mol. Its IUPAC name is ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 3594078 |
| Molecular Formula | C38H45F2NO5S |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CCOC(=O)N(CCc1cccs1)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(F)c(F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C38H45F2NO5S/c1-4-46-33(44)41(18-12-26-6-5-19-47-26)23-37(45)15-11-31-35(37,3)14-10-30-34(2)13-9-25(42)21-36(34)16-17-38(30,31)27(22-36)32(43)24-7-8-28(39)29(40)20-24/h5-8,16-17,19-20,22,25,30-31,42,45H,4,9-15,18,21,23H2,1-3H3 |
| InChIKey | RCMFVDMFNWKNFX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|