C43H55F2NO5 — CID 3455386
ethyl N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate (PubChem CID 3455386) has the molecular formula C43H55F2NO5 and a molecular weight of 703.91 g/mol. Its IUPAC name is ethyl N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate.
| Compound Name | ethyl N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate |
|---|---|
| PubChem CID | 3455386 |
| Molecular Formula | C43H55F2NO5 |
| Molecular Weight | 703.91 g/mol |
| Exact Mass | 703.40 |
| IUPAC Name | ethyl N-(1-adamantylmethyl)-N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]carbamate |
| SMILES | CCOC(=O)N(CC12CC3CC(CC(C3)C1)C2)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(F)c(F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C43H55F2NO5/c1-4-51-37(49)46(24-40-19-26-15-27(20-40)17-28(16-26)21-40)25-42(50)12-9-35-39(42,3)11-8-34-38(2)10-7-30(47)22-41(38)13-14-43(34,35)31(23-41)36(48)29-5-6-32(44)33(45)18-29/h5-6,13-14,18,23,26-28,30,34-35,47,50H,4,7-12,15-17,19-22,24-25H2,1-3H3 |
| InChIKey | IFOQHNFSBUEGQO-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.91 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|