C41H49F2NO3 — CID 3314996
[5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone (PubChem CID 3314996) has the molecular formula C41H49F2NO3 and a molecular weight of 641.84 g/mol. Its IUPAC name is [5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone.
| Compound Name | [5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 3314996 |
| Molecular Formula | C41H49F2NO3 |
| Molecular Weight | 641.84 g/mol |
| Exact Mass | 641.37 |
| IUPAC Name | [5-[(4-benzylpiperidin-1-yl)methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(3,4-difluorophenyl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C41H49F2NO3/c1-37-15-10-30(45)24-39(37)18-19-41(31(25-39)36(46)29-8-9-32(42)33(43)23-29)34(37)11-16-38(2)35(41)12-17-40(38,47)26-44-20-13-28(14-21-44)22-27-6-4-3-5-7-27/h3-9,18-19,23,25,28,30,34-35,45,47H,10-17,20-22,24,26H2,1-2H3 |
| InChIKey | CGYUWIZLJSXZBF-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.84 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|