C40H49FN2O4 — CID 3371100
[5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone (PubChem CID 3371100) has the molecular formula C40H49FN2O4 and a molecular weight of 640.84 g/mol. Its IUPAC name is [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone.
| Compound Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 3371100 |
| Molecular Formula | C40H49FN2O4 |
| Molecular Weight | 640.84 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | [5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2=CC34C=CC25C(CCC2(C)C5CCC2(O)CN2CCN(c5ccc(F)cc5)CC2)C3(C)CCC(O)C4)cc1 |
| InChI | InChI=1S/C40H49FN2O4/c1-36-15-12-30(44)24-38(36)18-19-40(32(25-38)35(45)27-4-10-31(47-3)11-5-27)33(36)13-16-37(2)34(40)14-17-39(37,46)26-42-20-22-43(23-21-42)29-8-6-28(41)7-9-29/h4-11,18-19,25,30,33-34,44,46H,12-17,20-24,26H2,1-3H3 |
| InChIKey | UURRITYOFVGTOV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.84 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|