C41H48N2O4 — CID 4105227
[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone (PubChem CID 4105227) has the molecular formula C41H48N2O4 and a molecular weight of 632.85 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 4105227 |
| Molecular Formula | C41H48N2O4 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2=CC34C=CC25C(CCC2(C)C5CCC2(O)CN2CCc5c([nH]c6ccccc56)C2)C3(C)CCC(O)C4)cc1 |
| InChI | InChI=1S/C41H48N2O4/c1-37-16-12-27(44)22-39(37)19-20-41(31(23-39)36(45)26-8-10-28(47-3)11-9-26)34(37)13-17-38(2)35(41)14-18-40(38,46)25-43-21-15-30-29-6-4-5-7-32(29)42-33(30)24-43/h4-11,19-20,23,27,34-35,42,44,46H,12-18,21-22,24-25H2,1-3H3 |
| InChIKey | IECKNNFSGDMUMX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|