C45H52N2O6 — CID 5096088
1-benzyl-1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)urea (PubChem CID 5096088) has the molecular formula C45H52N2O6 and a molecular weight of 716.92 g/mol. Its IUPAC name is 1-benzyl-1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-benzyl-1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 5096088 |
| Molecular Formula | C45H52N2O6 |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | 1-benzyl-1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N(Cc2ccccc2)CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccc(OC)cc4)CC(O)CCC6(C)C5CCC32C)cc1 |
| InChI | InChI=1S/C45H52N2O6/c1-41-21-18-33(48)26-43(41)24-25-45(36(27-43)39(49)31-10-14-34(52-3)15-11-31)37(41)19-22-42(2)38(45)20-23-44(42,51)29-47(28-30-8-6-5-7-9-30)40(50)46-32-12-16-35(53-4)17-13-32/h5-17,24-25,27,33,37-38,48,51H,18-23,26,28-29H2,1-4H3,(H,46,50) |
| InChIKey | XXUWMIRRYFSBCR-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|