C40H50N2O5 — CID 6667652
1-[[(1R,2S,5S,6S,9R,10R,15R)-17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea (PubChem CID 6667652) has the molecular formula C40H50N2O5 and a molecular weight of 638.85 g/mol. Its IUPAC name is 1-[[(1R,2S,5S,6S,9R,10R,15R)-17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea.
| Compound Name | 1-[[(1R,2S,5S,6S,9R,10R,15R)-17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
|---|---|
| PubChem CID | 6667652 |
| Molecular Formula | C40H50N2O5 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 1-[[(1R,2S,5S,6S,9R,10R,15R)-17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
| SMILES | COCCCN(C[C@]1(O)CC[C@H]2[C@]34C=C[C@@]5(C=C3C(=O)c3ccccc3)CC(O)CC[C@]5(C)[C@H]4CC[C@@]21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C40H50N2O5/c1-36-18-15-30(43)25-38(36)21-22-40(31(26-38)34(44)28-11-6-4-7-12-28)32(36)16-19-37(2)33(40)17-20-39(37,46)27-42(23-10-24-47-3)35(45)41-29-13-8-5-9-14-29/h4-9,11-14,21-22,26,30,32-33,43,46H,10,15-20,23-25,27H2,1-3H3,(H,41,45)/t30?,32-,33-,36-,37+,38+,39-,40-/m1/s1 |
| InChIKey | DKNZOEFVPZXWQT-IPRVPUFFSA-N |
| XLogP | 7.03 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|