C42H50N2O5S — CID 3484055
1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea (PubChem CID 3484055) has the molecular formula C42H50N2O5S and a molecular weight of 694.94 g/mol. Its IUPAC name is 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea.
| Compound Name | 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
|---|---|
| PubChem CID | 3484055 |
| Molecular Formula | C42H50N2O5S |
| Molecular Weight | 694.94 g/mol |
| Exact Mass | 694.34 |
| IUPAC Name | 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-phenylurea |
| SMILES | COCCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cc6ccccc6s3)CC(O)CCC5(C)C4CCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C42H50N2O5S/c1-38-17-14-30(45)25-40(38)20-21-42(31(26-40)36(46)33-24-28-10-7-8-13-32(28)50-33)34(38)15-18-39(2)35(42)16-19-41(39,48)27-44(22-9-23-49-3)37(47)43-29-11-5-4-6-12-29/h4-8,10-13,20-21,24,26,30,34-35,45,48H,9,14-19,22-23,25,27H2,1-3H3,(H,43,47) |
| InChIKey | OVFGGNJPPRITKW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.94 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|