C40H50N2O5 — CID 4050131
1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea (PubChem CID 4050131) has the molecular formula C40H50N2O5 and a molecular weight of 638.85 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea.
| Compound Name | 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea |
|---|---|
| PubChem CID | 4050131 |
| Molecular Formula | C40H50N2O5 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.37 |
| IUPAC Name | 1-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea |
| SMILES | CCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(OC)cc3)CC(O)CCC5(C)C4CCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C40H50N2O5/c1-5-23-42(35(45)41-28-9-7-6-8-10-28)26-39(46)20-17-33-37(39,3)19-16-32-36(2)18-15-29(43)24-38(36)21-22-40(32,33)31(25-38)34(44)27-11-13-30(47-4)14-12-27/h6-14,21-22,25,29,32-33,43,46H,5,15-20,23-24,26H2,1-4H3,(H,41,45) |
| InChIKey | BZQFMGOXDKVSCX-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|