C48H56N2O6 — CID 5235718
1-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 5235718) has the molecular formula C48H56N2O6 and a molecular weight of 756.98 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 5235718 |
| Molecular Formula | C48H56N2O6 |
| Molecular Weight | 756.98 g/mol |
| Exact Mass | 756.41 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | COc1ccc(NC(=O)N(CC2CCCO2)CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccccc4-c4ccccc4)CC(O)CCC6(C)C5CCC32C)cc1 |
| InChI | InChI=1S/C48H56N2O6/c1-44-22-19-34(51)28-46(44)25-26-48(39(29-46)42(52)38-14-8-7-13-37(38)32-10-5-4-6-11-32)40(44)20-23-45(2)41(48)21-24-47(45,54)31-50(30-36-12-9-27-56-36)43(53)49-33-15-17-35(55-3)18-16-33/h4-8,10-11,13-18,25-26,29,34,36,40-41,51,54H,9,12,19-24,27-28,30-31H2,1-3H3,(H,49,53) |
| InChIKey | LCNPUTPCSOOXHC-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.98 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|