C42H50F2N2O6 — CID 3598360
1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea (PubChem CID 3598360) has the molecular formula C42H50F2N2O6 and a molecular weight of 716.87 g/mol. Its IUPAC name is 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 3598360 |
| Molecular Formula | C42H50F2N2O6 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | 1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-(4-methoxyphenyl)-1-(oxolan-2-ylmethyl)urea |
| SMILES | COc1ccc(NC(=O)N(CC2CCCO2)CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccc(F)c(F)c4)CC(O)CCC6(C)C5CCC32C)cc1 |
| InChI | InChI=1S/C42H50F2N2O6/c1-38-15-12-28(47)22-40(38)18-19-42(31(23-40)36(48)26-6-11-32(43)33(44)21-26)34(38)13-16-39(2)35(42)14-17-41(39,50)25-46(24-30-5-4-20-52-30)37(49)45-27-7-9-29(51-3)10-8-27/h6-11,18-19,21,23,28,30,34-35,47,50H,4-5,12-17,20,22,24-25H2,1-3H3,(H,45,49) |
| InChIKey | FZQHCPFGQLNOLB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|