C45H49F2NO6 — CID 5147504
naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate (PubChem CID 5147504) has the molecular formula C45H49F2NO6 and a molecular weight of 737.88 g/mol. Its IUPAC name is naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate.
| Compound Name | naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 5147504 |
| Molecular Formula | C45H49F2NO6 |
| Molecular Weight | 737.88 g/mol |
| Exact Mass | 737.35 |
| IUPAC Name | naphthalen-2-yl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)carbamate |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(CC1CCCO1)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C45H49F2NO6/c1-41-16-13-31(49)24-43(41)19-20-45(34(25-43)39(50)30-10-12-35(46)36(47)23-30)37(41)14-17-42(2)38(45)15-18-44(42,52)27-48(26-33-8-5-21-53-33)40(51)54-32-11-9-28-6-3-4-7-29(28)22-32/h3-4,6-7,9-12,19-20,22-23,25,31,33,37-38,49,52H,5,8,13-18,21,24,26-27H2,1-2H3 |
| InChIKey | VVZWFKBESPIMFF-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.88 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|