C47H56F2N2O4 — CID 3581144
1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea (PubChem CID 3581144) has the molecular formula C47H56F2N2O4 and a molecular weight of 750.97 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea.
| Compound Name | 1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 3581144 |
| Molecular Formula | C47H56F2N2O4 |
| Molecular Weight | 750.97 g/mol |
| Exact Mass | 750.42 |
| IUPAC Name | 1-(1-adamantylmethyl)-1-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN(CC12CC3CC(CC(C3)C1)C2)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C47H56F2N2O4/c1-42-13-10-34(52)25-45(42)16-17-47(35(26-45)40(53)32-8-9-36(48)37(49)21-32)38(42)11-14-43(2)39(47)12-15-46(43,55)28-51(41(54)50-33-6-4-3-5-7-33)27-44-22-29-18-30(23-44)20-31(19-29)24-44/h3-9,16-17,21,26,29-31,34,38-39,52,55H,10-15,18-20,22-25,27-28H2,1-2H3,(H,50,54) |
| InChIKey | NXNZBFCAVGUIMQ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.97 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|