C39H54N2O4 — CID 4119600
1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea (PubChem CID 4119600) has the molecular formula C39H54N2O4 and a molecular weight of 614.87 g/mol. Its IUPAC name is 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea.
| Compound Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea |
|---|---|
| PubChem CID | 4119600 |
| Molecular Formula | C39H54N2O4 |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.41 |
| IUPAC Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenyl-1-propylurea |
| SMILES | CCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C39H54N2O4/c1-4-23-41(34(44)40-28-13-9-6-10-14-28)26-38(45)20-17-32-36(38,3)19-16-31-35(2)18-15-29(42)24-37(35)21-22-39(31,32)30(25-37)33(43)27-11-7-5-8-12-27/h6,9-10,13-14,21-22,25,27,29,31-32,42,45H,4-5,7-8,11-12,15-20,23-24,26H2,1-3H3,(H,40,44) |
| InChIKey | PEGUSBXZOIIPJV-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|