C49H50N2O4S — CID 4294014
1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea (PubChem CID 4294014) has the molecular formula C49H50N2O4S and a molecular weight of 763.02 g/mol. Its IUPAC name is 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea.
| Compound Name | 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 4294014 |
| Molecular Formula | C49H50N2O4S |
| Molecular Weight | 763.02 g/mol |
| Exact Mass | 762.35 |
| IUPAC Name | 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(naphthalen-1-ylmethyl)-3-phenylurea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cc5ccccc5s4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1cccc2ccccc12)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C49H50N2O4S/c1-45-22-19-36(52)28-47(45)25-26-49(38(29-47)43(53)40-27-33-12-7-9-18-39(33)56-40)41(45)20-23-46(2)42(49)21-24-48(46,55)31-51(44(54)50-35-15-4-3-5-16-35)30-34-14-10-13-32-11-6-8-17-37(32)34/h3-18,25-27,29,36,41-42,52,55H,19-24,28,30-31H2,1-2H3,(H,50,54) |
| InChIKey | PMEHUZKELWFXFX-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.02 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|