C39H52N2O5S — CID 5076652
1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea (PubChem CID 5076652) has the molecular formula C39H52N2O5S and a molecular weight of 660.92 g/mol. Its IUPAC name is 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea.
| Compound Name | 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 5076652 |
| Molecular Formula | C39H52N2O5S |
| Molecular Weight | 660.92 g/mol |
| Exact Mass | 660.36 |
| IUPAC Name | 1-[[17-(1-benzothiophene-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-(3-methoxypropyl)-3-propan-2-ylurea |
| SMILES | COCCCN(CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cc6ccccc6s3)CC(O)CCC5(C)C4CCC21C)C(=O)NC(C)C |
| InChI | InChI=1S/C39H52N2O5S/c1-25(2)40-34(44)41(19-8-20-46-5)24-38(45)16-13-32-36(38,4)15-12-31-35(3)14-11-27(42)22-37(35)17-18-39(31,32)28(23-37)33(43)30-21-26-9-6-7-10-29(26)47-30/h6-7,9-10,17-18,21,23,25,27,31-32,42,45H,8,11-16,19-20,22,24H2,1-5H3,(H,40,44) |
| InChIKey | RSJIKSRVGSQEAR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.92 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|