C38H51NO3 — CID 4547302
cyclohexyl-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4547302) has the molecular formula C38H51NO3 and a molecular weight of 569.83 g/mol. Its IUPAC name is cyclohexyl-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4547302 |
| Molecular Formula | C38H51NO3 |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.39 |
| IUPAC Name | cyclohexyl-[5-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C38H51NO3/c1-34-16-12-29(40)22-36(34)19-20-38(30(23-36)33(41)27-9-4-3-5-10-27)31(34)13-17-35(2)32(38)14-18-37(35,42)25-39-21-15-26-8-6-7-11-28(26)24-39/h6-8,11,19-20,23,27,29,31-32,40,42H,3-5,9-10,12-18,21-22,24-25H2,1-2H3 |
| InChIKey | UUAHKSFLLXDEER-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|