C38H52N2O5 — CID 4051346
cyclohexyl-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4051346) has the molecular formula C38H52N2O5 and a molecular weight of 616.84 g/mol. Its IUPAC name is cyclohexyl-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4051346 |
| Molecular Formula | C38H52N2O5 |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.39 |
| IUPAC Name | cyclohexyl-[5-[[4-(furan-2-carbonyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C38H52N2O5/c1-34-13-10-27(41)23-36(34)16-17-38(28(24-36)32(42)26-7-4-3-5-8-26)30(34)11-14-35(2)31(38)12-15-37(35,44)25-39-18-20-40(21-19-39)33(43)29-9-6-22-45-29/h6,9,16-17,22,24,26-27,30-31,41,44H,3-5,7-8,10-15,18-21,23,25H2,1-2H3 |
| InChIKey | HQMVESQRRKBKIQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|