C40H48ClFN2O4 — CID 5202986
2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-5-[[4-(2-hydroxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 5202986) has the molecular formula C40H48ClFN2O4 and a molecular weight of 675.29 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-5-[[4-(2-hydroxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-5-[[4-(2-hydroxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 5202986 |
| Molecular Formula | C40H48ClFN2O4 |
| Molecular Weight | 675.29 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-5-[[4-(2-hydroxyphenyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C40H48ClFN2O4/c1-36-13-10-26(45)23-38(36)16-17-40(28(24-38)33(47)22-27-29(41)6-5-7-30(27)42)34(36)11-14-37(2)35(40)12-15-39(37,48)25-43-18-20-44(21-19-43)31-8-3-4-9-32(31)46/h3-9,16-17,24,26,34-35,45-46,48H,10-15,18-23,25H2,1-2H3 |
| InChIKey | ASCQMEINKXJGSZ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.29 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|