C34H43ClFNO4 — CID 5054373
2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 5054373) has the molecular formula C34H43ClFNO4 and a molecular weight of 584.17 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 5054373 |
| Molecular Formula | C34H43ClFNO4 |
| Molecular Weight | 584.17 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1CCOCC1 |
| InChI | InChI=1S/C34H43ClFNO4/c1-30-9-6-22(38)19-32(30)12-13-34(24(20-32)27(39)18-23-25(35)4-3-5-26(23)36)28(30)7-10-31(2)29(34)8-11-33(31,40)21-37-14-16-41-17-15-37/h3-5,12-13,20,22,28-29,38,40H,6-11,14-19,21H2,1-2H3 |
| InChIKey | BAZSKARFKFQVGR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.17 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|