C39H47ClFN3O3 — CID 5212103
2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone (PubChem CID 5212103) has the molecular formula C39H47ClFN3O3 and a molecular weight of 660.27 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
|---|---|
| PubChem CID | 5212103 |
| Molecular Formula | C39H47ClFN3O3 |
| Molecular Weight | 660.27 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C39H47ClFN3O3/c1-35-12-9-26(45)23-37(35)15-16-39(28(24-37)31(46)22-27-29(40)6-5-7-30(27)41)32(35)10-13-36(2)33(39)11-14-38(36,47)25-43-18-20-44(21-19-43)34-8-3-4-17-42-34/h3-8,15-17,24,26,32-33,45,47H,9-14,18-23,25H2,1-2H3 |
| InChIKey | WNYRSCXQTZUZCX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.27 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|