C38H53N3O3 — CID 6725264
cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 6725264) has the molecular formula C38H53N3O3 and a molecular weight of 599.86 g/mol. Its IUPAC name is cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 6725264 |
| Molecular Formula | C38H53N3O3 |
| Molecular Weight | 599.86 g/mol |
| Exact Mass | 599.41 |
| IUPAC Name | cyclohexyl-[(1R,2S,5S,6S,9R,10R,15R)-5,13-dihydroxy-6,10-dimethyl-5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | C[C@]12CC[C@H]3[C@]4(C=C[C@@]5(C=C4C(=O)C4CCCCC4)CC(O)CC[C@]35C)[C@@H]1CC[C@@]2(O)CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C38H53N3O3/c1-34-14-11-28(42)24-36(34)17-18-38(29(25-36)33(43)27-8-4-3-5-9-27)30(34)12-15-35(2)31(38)13-16-37(35,44)26-40-20-22-41(23-21-40)32-10-6-7-19-39-32/h6-7,10,17-19,25,27-28,30-31,42,44H,3-5,8-9,11-16,20-24,26H2,1-2H3/t28?,30-,31-,34-,35+,36+,37-,38-/m1/s1 |
| InChIKey | CXUNPLTWZOWHMZ-SWPAKZBPSA-N |
| XLogP | 5.94 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.86 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|