C42H57N3O4 — CID 4060276
8-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 4060276) has the molecular formula C42H57N3O4 and a molecular weight of 667.94 g/mol. Its IUPAC name is 8-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 4060276 |
| Molecular Formula | C42H57N3O4 |
| Molecular Weight | 667.94 g/mol |
| Exact Mass | 667.43 |
| IUPAC Name | 8-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC2(CC1)C(=O)NCN2c1ccccc1 |
| InChI | InChI=1S/C42H57N3O4/c1-37-16-13-31(46)25-39(37)19-20-42(32(26-39)35(47)29-9-5-3-6-10-29)33(37)14-17-38(2)34(42)15-18-41(38,49)27-44-23-21-40(22-24-44)36(48)43-28-45(40)30-11-7-4-8-12-30/h4,7-8,11-12,19-20,26,29,31,33-34,46,49H,3,5-6,9-10,13-18,21-25,27-28H2,1-2H3,(H,43,48) |
| InChIKey | FEABEZZRPWFLJT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.94 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|