C41H55N3O4 — CID 4300897
3-[1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 4300897) has the molecular formula C41H55N3O4 and a molecular weight of 653.91 g/mol. Its IUPAC name is 3-[1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 4300897 |
| Molecular Formula | C41H55N3O4 |
| Molecular Weight | 653.91 g/mol |
| Exact Mass | 653.42 |
| IUPAC Name | 3-[1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C41H55N3O4/c1-37-17-12-29(45)24-39(37)20-21-41(30(25-39)35(46)27-8-4-3-5-9-27)33(37)13-18-38(2)34(41)14-19-40(38,48)26-43-22-15-28(16-23-43)44-32-11-7-6-10-31(32)42-36(44)47/h6-7,10-11,20-21,25,27-29,33-34,45,48H,3-5,8-9,12-19,22-24,26H2,1-2H3,(H,42,47) |
| InChIKey | QSILOHCECISGKC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.91 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|