C34H45NO3 — CID 4049418
[5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone (PubChem CID 4049418) has the molecular formula C34H45NO3 and a molecular weight of 515.74 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone |
|---|---|
| PubChem CID | 4049418 |
| Molecular Formula | C34H45NO3 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(piperidin-1-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-phenylmethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccccc4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCCC1 |
| InChI | InChI=1S/C34H45NO3/c1-30-14-11-25(36)21-32(30)17-18-34(26(22-32)29(37)24-9-5-3-6-10-24)27(30)12-15-31(2)28(34)13-16-33(31,38)23-35-19-7-4-8-20-35/h3,5-6,9-10,17-18,22,25,27-28,36,38H,4,7-8,11-16,19-21,23H2,1-2H3 |
| InChIKey | KEHOHNZEHZJMGK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|