C34H42F3NO4 — CID 5054234
[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 5054234) has the molecular formula C34H42F3NO4 and a molecular weight of 585.71 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 5054234 |
| Molecular Formula | C34H42F3NO4 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCOCC1 |
| InChI | InChI=1S/C34H42F3NO4/c1-29-9-6-24(39)19-31(29)12-13-33(25(20-31)28(40)22-4-3-5-23(18-22)34(35,36)37)26(29)7-10-30(2)27(33)8-11-32(30,41)21-38-14-16-42-17-15-38/h3-5,12-13,18,20,24,26-27,39,41H,6-11,14-17,19,21H2,1-2H3 |
| InChIKey | PJXPVULMNKOUGT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|