C39H46F3NO5S — CID 4128727
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate (PubChem CID 4128727) has the molecular formula C39H46F3NO5S and a molecular weight of 697.86 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
|---|---|
| PubChem CID | 4128727 |
| Molecular Formula | C39H46F3NO5S |
| Molecular Weight | 697.86 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(2-thiophen-2-ylethyl)carbamate |
| SMILES | CCOC(=O)N(CCc1cccs1)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C39H46F3NO5S/c1-4-48-33(46)43(19-13-28-9-6-20-49-28)24-37(47)16-12-31-35(37,3)15-11-30-34(2)14-10-27(44)22-36(34)17-18-38(30,31)29(23-36)32(45)25-7-5-8-26(21-25)39(40,41)42/h5-9,17-18,20-21,23,27,30-31,44,47H,4,10-16,19,22,24H2,1-3H3 |
| InChIKey | KUXSPEYPJZCBIS-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.86 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|