C46H59NO4 — CID 3522351
cyclohexyl-[5,13-dihydroxy-5-[[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3522351) has the molecular formula C46H59NO4 and a molecular weight of 689.98 g/mol. Its IUPAC name is cyclohexyl-[5,13-dihydroxy-5-[[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5,13-dihydroxy-5-[[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3522351 |
| Molecular Formula | C46H59NO4 |
| Molecular Weight | 689.98 g/mol |
| Exact Mass | 689.44 |
| IUPAC Name | cyclohexyl-[5,13-dihydroxy-5-[[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCC1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H59NO4/c1-41-23-20-35(48)29-43(41)26-27-45(36(30-43)40(49)32-13-6-3-7-14-32)37(41)21-24-42(2)38(45)22-25-44(42,50)31-47-28-12-19-39(47)46(51,33-15-8-4-9-16-33)34-17-10-5-11-18-34/h4-5,8-11,15-18,26-27,30,32,35,37-39,48,50-51H,3,6-7,12-14,19-25,28-29,31H2,1-2H3 |
| InChIKey | DIPOFHGOVPPVFW-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.98 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|