C40H49ClFNO5 — CID 3657563
1-[5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 3657563) has the molecular formula C40H49ClFNO5 and a molecular weight of 678.29 g/mol. Its IUPAC name is 1-[5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-[5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 3657563 |
| Molecular Formula | C40H49ClFNO5 |
| Molecular Weight | 678.29 g/mol |
| Exact Mass | 677.33 |
| IUPAC Name | 1-[5-[[benzyl(2,3-dihydroxypropyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1ccccc1)CC(O)CO |
| InChI | InChI=1S/C40H49ClFNO5/c1-36-14-11-27(45)20-38(36)17-18-40(30(21-38)33(47)19-29-31(41)9-6-10-32(29)42)34(36)12-15-37(2)35(40)13-16-39(37,48)25-43(23-28(46)24-44)22-26-7-4-3-5-8-26/h3-10,17-18,21,27-28,34-35,44-46,48H,11-16,19-20,22-25H2,1-2H3 |
| InChIKey | OFXVTEOTFRVEPA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.29 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|