C44H48ClFN2O4 — CID 3505598
1-benzyl-1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea (PubChem CID 3505598) has the molecular formula C44H48ClFN2O4 and a molecular weight of 723.33 g/mol. Its IUPAC name is 1-benzyl-1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea.
| Compound Name | 1-benzyl-1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 3505598 |
| Molecular Formula | C44H48ClFN2O4 |
| Molecular Weight | 723.33 g/mol |
| Exact Mass | 722.33 |
| IUPAC Name | 1-benzyl-1-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-3-phenylurea |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)Cc4c(F)cccc4Cl)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C44H48ClFN2O4/c1-40-19-16-31(49)25-42(40)22-23-44(33(26-42)36(50)24-32-34(45)14-9-15-35(32)46)37(40)17-20-41(2)38(44)18-21-43(41,52)28-48(27-29-10-5-3-6-11-29)39(51)47-30-12-7-4-8-13-30/h3-15,22-23,26,31,37-38,49,52H,16-21,24-25,27-28H2,1-2H3,(H,47,51) |
| InChIKey | BNIOFIQALMFLMJ-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.33 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|