C35H49NO7 — CID 3555338
[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone (PubChem CID 3555338) has the molecular formula C35H49NO7 and a molecular weight of 595.78 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3555338 |
| Molecular Formula | C35H49NO7 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(furan-2-yl)methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccco4)=C3)C2CCC2(C)C1CCC2(O)CN(CC(O)CO)CC1CCCO1 |
| InChI | InChI=1S/C35H49NO7/c1-31-10-7-23(38)17-33(31)13-14-35(26(18-33)30(40)27-6-4-16-43-27)28(31)8-11-32(2)29(35)9-12-34(32,41)22-36(19-24(39)21-37)20-25-5-3-15-42-25/h4,6,13-14,16,18,23-25,28-29,37-39,41H,3,5,7-12,15,17,19-22H2,1-2H3 |
| InChIKey | HDQXHXSPXGFZKS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|