C41H51NO6S — CID 5069043
N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide (PubChem CID 5069043) has the molecular formula C41H51NO6S and a molecular weight of 685.93 g/mol. Its IUPAC name is N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide.
| Compound Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 5069043 |
| Molecular Formula | C41H51NO6S |
| Molecular Weight | 685.93 g/mol |
| Exact Mass | 685.34 |
| IUPAC Name | N-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]-N-(oxolan-2-ylmethyl)methanesulfonamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(-c5ccccc5)cc4)=C3)C2CCC2(C)C1CCC2(O)CN(CC1CCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C41H51NO6S/c1-37-18-15-31(43)24-39(37)21-22-41(33(25-39)36(44)30-13-11-29(12-14-30)28-8-5-4-6-9-28)34(37)16-19-38(2)35(41)17-20-40(38,45)27-42(49(3,46)47)26-32-10-7-23-48-32/h4-6,8-9,11-14,21-22,25,31-32,34-35,43,45H,7,10,15-20,23-24,26-27H2,1-3H3 |
| InChIKey | OPSQQBYSGORASM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.93 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|