C38H44F3NO6S — CID 4293848
N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide (PubChem CID 4293848) has the molecular formula C38H44F3NO6S and a molecular weight of 699.83 g/mol. Its IUPAC name is N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide.
| Compound Name | N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 4293848 |
| Molecular Formula | C38H44F3NO6S |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | N-[(17-benzoyl-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl)methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccccc4)=C3)C2CCC2(C)C1CCC2(O)CN(Cc1ccc(OC(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C38H44F3NO6S/c1-33-16-13-27(43)21-35(33)19-20-37(29(22-35)32(44)26-7-5-4-6-8-26)30(33)14-17-34(2)31(37)15-18-36(34,45)24-42(49(3,46)47)23-25-9-11-28(12-10-25)48-38(39,40)41/h4-12,19-20,22,27,30-31,43,45H,13-18,21,23-24H2,1-3H3 |
| InChIKey | XJWABQPYYVHJOA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|