C38H47NO4 — CID 4250517
[5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-phenylphenyl)methanone (PubChem CID 4250517) has the molecular formula C38H47NO4 and a molecular weight of 581.80 g/mol. Its IUPAC name is [5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-phenylphenyl)methanone.
| Compound Name | [5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 4250517 |
| Molecular Formula | C38H47NO4 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | [5,13-dihydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-(4-phenylphenyl)methanone |
| SMILES | CN(CCO)CC1(O)CCC2C34C=CC5(C=C3C(=O)c3ccc(-c6ccccc6)cc3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C38H47NO4/c1-34-16-13-29(41)23-36(34)19-20-38(30(24-36)33(42)28-11-9-27(10-12-28)26-7-5-4-6-8-26)31(34)14-17-35(2)32(38)15-18-37(35,43)25-39(3)21-22-40/h4-12,19-20,24,29,31-32,40-41,43H,13-18,21-23,25H2,1-3H3 |
| InChIKey | WVSGLWXZNKVRJP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|