C42H46N2O3S — CID 5143561
1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 5143561) has the molecular formula C42H46N2O3S and a molecular weight of 658.91 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 5143561 |
| Molecular Formula | C42H46N2O3S |
| Molecular Weight | 658.91 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | 1-benzothiophen-2-yl-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cc5ccccc5s4)=C3)C2CCC2(C)C1CCC2(O)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C42H46N2O3S/c1-38-15-11-27(45)22-40(38)18-19-42(30(23-40)37(46)34-21-26-7-3-6-10-33(26)48-34)35(38)12-16-39(2)36(42)13-17-41(39,47)25-44-20-14-29-28-8-4-5-9-31(28)43-32(29)24-44/h3-10,18-19,21,23,27,35-36,43,45,47H,11-17,20,22,24-25H2,1-2H3 |
| InChIKey | WEQXSHDMJCBBAF-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.91 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|