C40H44F2N2O3 — CID 5143560
(3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 5143560) has the molecular formula C40H44F2N2O3 and a molecular weight of 638.80 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | (3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 5143560 |
| Molecular Formula | C40H44F2N2O3 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | (3,4-difluorophenyl)-[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4ccc(F)c(F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C40H44F2N2O3/c1-36-13-9-25(45)20-38(36)16-17-40(28(21-38)35(46)24-7-8-29(41)30(42)19-24)33(36)10-14-37(2)34(40)11-15-39(37,47)23-44-18-12-27-26-5-3-4-6-31(26)43-32(27)22-44/h3-8,16-17,19,21,25,33-34,43,45,47H,9-15,18,20,22-23H2,1-2H3 |
| InChIKey | FSPGNZRYMFROPY-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|