C41H45F3N2O3 — CID 5143562
[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 5143562) has the molecular formula C41H45F3N2O3 and a molecular weight of 670.82 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 5143562 |
| Molecular Formula | C41H45F3N2O3 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)c4cccc(C(F)(F)F)c4)=C3)C2CCC2(C)C1CCC2(O)CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C41H45F3N2O3/c1-36-14-10-27(47)21-38(36)17-18-40(30(22-38)35(48)25-6-5-7-26(20-25)41(42,43)44)33(36)11-15-37(2)34(40)12-16-39(37,49)24-46-19-13-29-28-8-3-4-9-31(28)45-32(29)23-46/h3-9,17-18,20,22,27,33-34,45,47,49H,10-16,19,21,23-24H2,1-2H3 |
| InChIKey | MSAVXWRKRAQALI-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|