C39H46N2O3S — CID 4104465
[5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone (PubChem CID 4104465) has the molecular formula C39H46N2O3S and a molecular weight of 622.88 g/mol. Its IUPAC name is [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 4104465 |
| Molecular Formula | C39H46N2O3S |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | [5,13-dihydroxy-6,10-dimethyl-5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(5-methylthiophen-2-yl)methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN2CCc3c([nH]c4ccccc34)C2)c2ccc(cc2C(=O)c2ccc(C)s2)CC(O)CC1 |
| InChI | InChI=1S/C39H46N2O3S/c1-25-7-6-18-38(3)33(16-19-39(38,44)24-41-20-17-31-30-8-4-5-9-34(30)40-35(31)23-41)29-14-12-27(21-28(42)13-10-25)22-32(29)37(43)36-15-11-26(2)45-36/h4-5,7-9,11-12,14-15,22,28,33,40,42,44H,6,10,13,16-21,23-24H2,1-3H3 |
| InChIKey | NZNKHJAYERPCAE-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|